CAS 38594-62-6 is the registry number for 2-Ethyl-4-nitropyridine 1-oxide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethyl-4-nitro-1-oxidopyridin-1-ium (CAS 38594-62-6) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2-ethyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: KKALKJBYTZOONQ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-ethyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | KKALKJBYTZOONQ-UHFFFAOYSA-N |
| SMILES | CCC1=[N+](C=CC(=C1)[N+](=O)[O-])[O-] |
Computed by PubChem (NCBI)