Products 3880-88-4

CAS 3880-88-4 is the registry number for 5-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (CAS 3880-88-4) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride. InChIKey: CGLCAQWQPIFKRX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO
Molecular weight213.70 g/mol
IUPAC name5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride
InChIKeyCGLCAQWQPIFKRX-UHFFFAOYSA-N
SMILESCOC1=CC=CC2=C1CCC(C2)N.Cl

Computed by PubChem (NCBI)