CAS 58349-17-0 appears in our catalog under these names: (S)-2-Amino-5-methoxytetralin hydrochloride, 95%, (S)–(–)–5–methoxy–2–aminotetraline hydrochloride, (S)-2-Amino-5-methoxytetralin HCl, (S)-5-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride, 98%, 98%, (s)-2-Amino-5-methoxytetralin (hydrochloride), 99.98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 10mg, 0,5g, 0,25g, 5g, 10g, 100mg.
(2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (CAS 58349-17-0) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride. InChIKey: CGLCAQWQPIFKRX-FVGYRXGTSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| InChIKey | CGLCAQWQPIFKRX-FVGYRXGTSA-N |
| SMILES | COC1=CC=CC2=C1CC[C@@H](C2)N.Cl |
Computed by PubChem (NCBI)