CAS 388116-27-6 appears in our catalog under these names: Indole–4–boronic acid pinacol ester, Indole-4-Boronic Acid Pinacol Ester, 97%, 97%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 388116-27-6) is a chemical compound with the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: QDCIXBBEUHMLDN-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2 |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | QDCIXBBEUHMLDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CNC3=CC=C2 |
Computed by PubChem (NCBI)