CAS 38858-95-6 appears in our catalog under these names: 3(5)-tert-Butyl-4-nitro-1H-pyrazole, 98%, 3–(tert–Butyl)–4–nitro–1H–pyrazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
5-tert-butyl-4-nitro-1H-pyrazole (CAS 38858-95-6) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: 5-tert-butyl-4-nitro-1H-pyrazole. InChIKey: ZGZXLSKQZBZQOF-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-tert-butyl-4-nitro-1H-pyrazole |
| InChIKey | ZGZXLSKQZBZQOF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=NN1)[N+](=O)[O-] |
Computed by PubChem (NCBI)