CAS 38877-93-9 appears in our catalog under these names: (E)-6-(4,6-Dimethoxy-7-methyl-3-oxo-1,3-dihydroisobenzofuran-5-yl)-4-methylhex-4-enoic acid, 95%, Mycophenolic Acid O-Methyl Impurity, (E)-6-(1,3-Dihydro-4,6-dimethoxy-7-methyl-3-oxo-5-isobenzofuranyl)-4-methyl-4-hexenoic Acid, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 1g, 5g, on request, 25mg, 500mg, 50mg.
(E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid (CAS 38877-93-9) is a chemical compound with the molecular formula C18H22O6 and a molecular weight of 334.4 g/mol. IUPAC name: (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid. InChIKey: KPDDZPBBEIESMK-BJMVGYQFSA-N.
| Molecular formula | C18H22O6 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| InChIKey | KPDDZPBBEIESMK-BJMVGYQFSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)O)OC |
Computed by PubChem (NCBI)