Products 56772-00-0

CAS 56772-00-0 is the registry number for Strontium Ranelate Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenyl)benzene (CAS 56772-00-0) is a chemical compound with the molecular formula C18H22O6 and a molecular weight of 334.4 g/mol. IUPAC name: 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenyl)benzene. InChIKey: RKBIBGCWOVKDQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22O6
Molecular weight334.4 g/mol
IUPAC name1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenyl)benzene
InChIKeyRKBIBGCWOVKDQJ-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C2=CC(=C(C(=C2)OC)OC)OC

Computed by PubChem (NCBI)