Products 537-35-9

CAS 537-35-9 is the registry number for 4,4'-(Ethane-1,2-diyl)bis(2,6-dimethoxyphenol) 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenol (CAS 537-35-9) is a chemical compound with the molecular formula C18H22O6 and a molecular weight of 334.4 g/mol. IUPAC name: 4-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenol. InChIKey: HQXQRZVYMHCSMN-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22O6
Molecular weight334.4 g/mol
IUPAC name4-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenol
InChIKeyHQXQRZVYMHCSMN-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1O)OC)CCC2=CC(=C(C(=C2)OC)O)OC

Computed by PubChem (NCBI)