CAS 38902-68-0 appears in our catalog under these names: Trietazine-desethyl, 6-Chloro-N2,N2-diethyl-1,3,5-triazine-2,4-diamine, 95+%. Offered by: Dr. Ehrenstorfer, HPC Standards, Ambeed. Available pack sizes: 100mg, 1x100mg, 250mg, 1g.
6-chloro-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine (CAS 38902-68-0) is a chemical compound with the molecular formula C7H12ClN5 and a molecular weight of 201.66 g/mol. IUPAC name: 6-chloro-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine. InChIKey: IKPKORYHXFIOSN-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN5 |
|---|---|
| Molecular weight | 201.66 g/mol |
| IUPAC name | 6-chloro-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
| InChIKey | IKPKORYHXFIOSN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)