CAS 98336-32-4 is the registry number for 6-(1-Chloroethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
6-(1-chloroethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (CAS 98336-32-4) is a chemical compound with the molecular formula C7H12ClN5 and a molecular weight of 201.66 g/mol. IUPAC name: 6-(1-chloroethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine. InChIKey: SDSCOBGYAUKKBC-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN5 |
|---|---|
| Molecular weight | 201.66 g/mol |
| IUPAC name | 6-(1-chloroethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| InChIKey | SDSCOBGYAUKKBC-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NC(=N1)N(C)C)N)Cl |
Computed by PubChem (NCBI)