CAS 53115-46-1 is the registry number for 6-Chloro-N2-ethyl-N4,N4-dimethyl-1,3,5-triazine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (CAS 53115-46-1) is a chemical compound with the molecular formula C7H12ClN5 and a molecular weight of 201.66 g/mol. IUPAC name: 6-chloro-4-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine. InChIKey: CMIARNYKAHQBQX-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN5 |
|---|---|
| Molecular weight | 201.66 g/mol |
| IUPAC name | 6-chloro-4-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| InChIKey | CMIARNYKAHQBQX-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=NC(=N1)Cl)N(C)C |
Computed by PubChem (NCBI)