Products 389888-02-2
CAS 389888-02-2 appears in our catalog under these names: (S)-CPW 399, (S)–CPW 399. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, Get quote.
(2S)-2-amino-3-(2,4-dioxo-6,7-dihydro-5H-cyclopenta[d]pyrimidin-1-yl)propanoic acid (CAS 389888-02-2) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: (2S)-2-amino-3-(2,4-dioxo-6,7-dihydro-5H-cyclopenta[d]pyrimidin-1-yl)propanoic acid. InChIKey: VSGUEKZRMJVQOH-LURJTMIESA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,4-dioxo-6,7-dihydro-5H-cyclopenta[d]pyrimidin-1-yl)propanoic acid |
| InChIKey | VSGUEKZRMJVQOH-LURJTMIESA-N |
| SMILES | C1CC2=C(C1)N(C(=O)NC2=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)