CAS 39102-78-8 appears in our catalog under these names: 1,5-Anhydro-D-xylitol, 1,5-Anhydroxylitol. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 100mg.
(3R,5S)-oxane-3,4,5-triol (CAS 39102-78-8) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (3R,5S)-oxane-3,4,5-triol. InChIKey: QXAMTEJJAZOINB-NGQZWQHPSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (3R,5S)-oxane-3,4,5-triol |
| InChIKey | QXAMTEJJAZOINB-NGQZWQHPSA-N |
| SMILES | C1[C@H](C([C@H](CO1)O)O)O |
Computed by PubChem (NCBI)