CAS 39110-58-2 is the registry number for Methyl 2-deoxy-2-fluoro-β-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g.
(2R,3S,4S,5R,6R)-5-fluoro-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (CAS 39110-58-2) is a chemical compound with the molecular formula C7H13FO5 and a molecular weight of 196.17 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-5-fluoro-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol. InChIKey: CRIUOMMBWCCBCQ-NYMZXIIRSA-N.
| Molecular formula | C7H13FO5 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-5-fluoro-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| InChIKey | CRIUOMMBWCCBCQ-NYMZXIIRSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)F |
Computed by PubChem (NCBI)