Products 391248-21-8
CAS 391248-21-8 appears in our catalog under these names: Ethyl 2-(4'-aminophenyl)-1,3-oxazole-4-carboxylate, 95%, Ethyl 2-(4-aminophenyl)oxazole-4-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Ethyl 2-(4-aminophenyl)-1,3-oxazole-4-carboxylate (CAS 391248-21-8) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: ethyl 2-(4-aminophenyl)-1,3-oxazole-4-carboxylate. InChIKey: YQVSEWFNEJKQNV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | ethyl 2-(4-aminophenyl)-1,3-oxazole-4-carboxylate |
| InChIKey | YQVSEWFNEJKQNV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=COC(=N1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)