CAS 391248-22-9 appears in our catalog under these names: Ethyl 5-[(4'-n-boc-amino)phenyl]-1,3-oxazole-4-carboxylate, 95%, Ethyl 5-(4-((tert-butoxycarbonyl)amino)phenyl)oxazole-4-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,3-oxazole-4-carboxylate (CAS 391248-22-9) is a chemical compound with the molecular formula C17H20N2O5 and a molecular weight of 332.4 g/mol. IUPAC name: ethyl 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,3-oxazole-4-carboxylate. InChIKey: LCRZRPSRAUNHSV-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O5 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | ethyl 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,3-oxazole-4-carboxylate |
| InChIKey | LCRZRPSRAUNHSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC=N1)C2=CC=C(C=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)