CAS 745078-83-5 is the registry number for 5–(3–tert–butoxycarbonylamino–phenyl)–isoxazole–3–carboxylic acid ethyl ester. Offered by: GLPBio. Available pack sizes: 5g.
Ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,2-oxazole-3-carboxylate (CAS 745078-83-5) is a chemical compound with the molecular formula C17H20N2O5 and a molecular weight of 332.4 g/mol. IUPAC name: ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,2-oxazole-3-carboxylate. InChIKey: OTBPAPPKVWKVIE-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O5 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,2-oxazole-3-carboxylate |
| InChIKey | OTBPAPPKVWKVIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC(=CC=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)