CAS 47355-10-2 appears in our catalog under these names: Boc–Trp(For)–OH, Boc-L-Trp(For)-OH, Nalpha-(tert-Butoxycarbonyl)-N1-formyl-L-tryptophan, >98.0%(T), Boc-Trp(For)-OH 95%, Boc-Trp(For)-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
(2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 47355-10-2) is a chemical compound with the molecular formula C17H20N2O5 and a molecular weight of 332.4 g/mol. IUPAC name: (2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: IHXHBYFWSOYYTR-ZDUSSCGKSA-N.
| Molecular formula | C17H20N2O5 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | IHXHBYFWSOYYTR-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN(C2=CC=CC=C21)C=O)C(=O)O |
Computed by PubChem (NCBI)