CAS 3917-39-3 appears in our catalog under these names: trans-β-Ionylidene ethanol, (2E,4E)-b-Ionyliden-ethanol, (2E,4E)-beta-Ionyliden-ethanol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dien-1-ol (CAS 3917-39-3) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dien-1-ol. InChIKey: VSMDCVLKAAVJFW-ANKZSMJWSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dien-1-ol |
| InChIKey | VSMDCVLKAAVJFW-ANKZSMJWSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/CO)/C |
Computed by PubChem (NCBI)