CAS 391906-83-5 appears in our catalog under these names: 3-Phenoxypyridin-2-amine, 95%, 3–Phenoxypyridin–2–amine, 3-Phenoxypyridin-2-amine 95%, 2-Pyridinamine, 3-phenoxy-, 95%, 95%, 3-PHENOXYPYRIDIN-2-AMINE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.
3-phenoxypyridin-2-amine (CAS 391906-83-5) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 3-phenoxypyridin-2-amine. InChIKey: MJTHRNDBNYACBS-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 3-phenoxypyridin-2-amine |
| InChIKey | MJTHRNDBNYACBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(N=CC=C2)N |
Computed by PubChem (NCBI)