CAS 39241-02-6 appears in our catalog under these names: N-(3-Bromophenyl)-2-methylpropanamide, 95%, N–(3–bromophenyl)–2–methylpropanamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
N-(3-bromophenyl)-2-methylpropanamide (CAS 39241-02-6) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: N-(3-bromophenyl)-2-methylpropanamide. InChIKey: NKBABBOSWOTEAD-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | N-(3-bromophenyl)-2-methylpropanamide |
| InChIKey | NKBABBOSWOTEAD-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)