Products 39264-32-9
CAS 39264-32-9 is the registry number for (2-amino-5-chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2-amino-5-chlorophenyl)-(1-methylimidazol-2-yl)methanone (CAS 39264-32-9) is a chemical compound with the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-(1-methylimidazol-2-yl)methanone. InChIKey: MNKUUSUHXFYFRZ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-(1-methylimidazol-2-yl)methanone |
| InChIKey | MNKUUSUHXFYFRZ-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C(=O)C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)