Products 393516-56-8
CAS 393516-56-8 is the registry number for tert-Butyl (7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate (CAS 393516-56-8) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: tert-butyl N-(7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate. InChIKey: AIULUHCETYJAJC-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | tert-butyl N-(7-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate |
| InChIKey | AIULUHCETYJAJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCCC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)