Products 39491-78-6
CAS 39491-78-6 appears in our catalog under these names: Phenamacril, Phenamacril/ 99.37% (existing batch purity), Phenamacril, 99.55%, Phenamacril (Standard). Offered by: Chemat Brand, TRC, AmBeed, Dr. Ehrenstorfer, TargetMol. Available pack sizes: on request, 500mg, 50mg, 1g, 1mg, 5mg, 10mg, 25mg.
Ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate (CAS 39491-78-6) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate. InChIKey: YKRQBWKLHCEKQH-KHPPLWFESA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate |
| InChIKey | YKRQBWKLHCEKQH-KHPPLWFESA-N |
| SMILES | CCOC(=O)/C(=C(/C1=CC=CC=C1)\N)/C#N |
Computed by PubChem (NCBI)