CAS 39492-53-0 is the registry number for N-(3,4-Dimethylphenyl)anthranilic Acid. Offered by: TRC. Available pack sizes: 750mg.
2-(3,4-dimethylanilino)benzoic acid (CAS 39492-53-0) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-(3,4-dimethylanilino)benzoic acid. InChIKey: HGAQNVCHFGXGKU-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-(3,4-dimethylanilino)benzoic acid |
| InChIKey | HGAQNVCHFGXGKU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)