CAS 395059-21-9 appears in our catalog under these names: (2,5-Dibromo-1,4-phenylene)dimethanol, 95%, 95%, 2,5-DIBROMO-1,4-BENZENEDIMETHANOL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg, 10g.
[2,5-dibromo-4-(hydroxymethyl)phenyl]methanol (CAS 395059-21-9) is a chemical compound with the molecular formula C8H8Br2O2 and a molecular weight of 295.96 g/mol. IUPAC name: [2,5-dibromo-4-(hydroxymethyl)phenyl]methanol. InChIKey: ALNZHGZKERXBKV-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2O2 |
|---|---|
| Molecular weight | 295.96 g/mol |
| IUPAC name | [2,5-dibromo-4-(hydroxymethyl)phenyl]methanol |
| InChIKey | ALNZHGZKERXBKV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)CO)Br)CO |
Computed by PubChem (NCBI)