CAS 3962-66-1 appears in our catalog under these names: Progesterone Impurity 32, Estr-5(10)-ene-3,17-dione, >95% (HPLC), Estr-5(10)-ene-3,17-dione (1.0mg/ml in Acetonitrile), Estr-5(10)-ene-3,17-dione. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10g, 25g, 5g, 1x1ml, 500mg.
(8R,9S,13S,14S)-13-methyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (CAS 3962-66-1) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 272.4 g/mol. IUPAC name: (8R,9S,13S,14S)-13-methyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione. InChIKey: RORYLAUXKSWMQL-CBZIJGRNSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-13-methyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | RORYLAUXKSWMQL-CBZIJGRNSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3CCC(=O)C4 |
Computed by PubChem (NCBI)