CAS 5218-51-9 appears in our catalog under these names: Dienogest Impurity 13, Trenbolone Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(8S,13S,14S,17S)-17-hydroxy-13-methyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (CAS 5218-51-9) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 272.4 g/mol. IUPAC name: (8S,13S,14S,17S)-17-hydroxy-13-methyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one. InChIKey: YQTRUFSEOHTFSE-OWSLCNJRSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (8S,13S,14S,17S)-17-hydroxy-13-methyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| InChIKey | YQTRUFSEOHTFSE-OWSLCNJRSA-N |
| SMILES | C[C@]12CC=C3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3CCC(=O)C4 |
Computed by PubChem (NCBI)