CAS 79037-37-9 appears in our catalog under these names: Estradiol-16,16,17-d3, 17Beta-Estradiol-16,16,17-d3, >95% (HPLC), 17-beta-Estradiol D3 (16,16,17-D3), 17-beta-Estradiol D3 (16,16,17-D3) 100 µg/mL in Acetonitrile, 17beta-Estradiol-16,16,17-d3, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: on request, 100mg, 10mg, 1mg, 1ml, 0,05g, 0,01g, 5mg.
(8R,9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 79037-37-9) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 275.4 g/mol. IUPAC name: (8R,9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: VOXZDWNPVJITMN-SPGJGCHISA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | VOXZDWNPVJITMN-SPGJGCHISA-N |
| SMILES | [2H][C@]1([C@]2(CC[C@H]3[C@H]([C@@H]2CC1([2H])[2H])CCC4=C3C=CC(=C4)O)C)O |
Computed by PubChem (NCBI)