Products 3964-84-9
CAS 3964-84-9 is the registry number for Loratadine Impurity 60. Offered by: Chemat Brand. Available pack sizes: on request.
14-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (CAS 3964-84-9) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 14-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one. InChIKey: QUTFOGMNVSZBBB-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 14-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| InChIKey | QUTFOGMNVSZBBB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Cl)C(=O)C3=C1C=CC=N3 |
Computed by PubChem (NCBI)