CAS 39653-87-7 appears in our catalog under these names: 4-Methoxy-3-nitrophenyl acetate, 95%, 4-Methoxy-3-nitrophenyl acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
(4-methoxy-3-nitrophenyl) acetate (CAS 39653-87-7) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: (4-methoxy-3-nitrophenyl) acetate. InChIKey: XUZGGGXQVSZPDD-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | (4-methoxy-3-nitrophenyl) acetate |
| InChIKey | XUZGGGXQVSZPDD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)