CAS 39684-61-2 appears in our catalog under these names: (Z)-2-(Furan-2-yl)-2-(methoxyimino)acetic Acid, Cefuroxime EP Impurity I. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, 500mg, 50mg, on request.
(2Z)-2-(furan-2-yl)-2-methoxyiminoacetic acid (CAS 39684-61-2) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: (2Z)-2-(furan-2-yl)-2-methoxyiminoacetic acid. InChIKey: ZNQCEVIJOQZWLO-VURMDHGXSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | (2Z)-2-(furan-2-yl)-2-methoxyiminoacetic acid |
| InChIKey | ZNQCEVIJOQZWLO-VURMDHGXSA-N |
| SMILES | CO/N=C(/C1=CC=CO1)\C(=O)O |
Computed by PubChem (NCBI)