CAS 39773-47-2 appears in our catalog under these names: 3-Amino-3-(4-bromophenyl)propanoic acid, min. 95 %, 2 g, 3–Amino–3–(4–bromophenyl)propionic acid, 3-Amino-3-(4-bromophenyl)propanoic acid, 3-Amino-3-(4-bromophenyl)propionic Acid, 95%, 95%, 3-Amino-3-(4-bromophenyl)propanoic acid, min. 95 %, 5 g. Offered by: Roth, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 2g, 100g, 25g, 5g, 10g, 250mg, 1g, 50g.
3-amino-3-(4-bromophenyl)propanoic acid (CAS 39773-47-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 3-amino-3-(4-bromophenyl)propanoic acid. InChIKey: RBOUYDUXPMAYMJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 3-amino-3-(4-bromophenyl)propanoic acid |
| InChIKey | RBOUYDUXPMAYMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)N)Br |
Computed by PubChem (NCBI)