CAS 39807-68-6 is the registry number for 4-(4-nitrophenyl)-1H-1,2,3-triazole-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
5-(4-nitrophenyl)-2H-triazole-4-carbonitrile (CAS 39807-68-6) is a chemical compound with the molecular formula C9H5N5O2 and a molecular weight of 215.17 g/mol. IUPAC name: 5-(4-nitrophenyl)-2H-triazole-4-carbonitrile. InChIKey: LRPPUSZMPRBCAU-UHFFFAOYSA-N.
| Molecular formula | C9H5N5O2 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-2H-triazole-4-carbonitrile |
| InChIKey | LRPPUSZMPRBCAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNN=C2C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)