Products 398457-04-0
CAS 398457-04-0 is the registry number for Methyl 5-chloro-6-cyanonicotinate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 5mg, 10mg, 1g, 250mg.
Methyl 5-chloro-6-cyanopyridine-3-carboxylate (CAS 398457-04-0) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: methyl 5-chloro-6-cyanopyridine-3-carboxylate. InChIKey: FJPBMRJEHLCFSY-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | methyl 5-chloro-6-cyanopyridine-3-carboxylate |
| InChIKey | FJPBMRJEHLCFSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)C#N)Cl |
Computed by PubChem (NCBI)