CAS 39876-84-1 appears in our catalog under these names: 2–(1,2,4–Triazol–1–yl)aniline, 2-(1H-1,2,4-Triazol-1-yl)aniline, 2-(1H-1,2,4-triazol-1-yl)aniline, 95%. Offered by: GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-(1,2,4-triazol-1-yl)aniline (CAS 39876-84-1) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 2-(1,2,4-triazol-1-yl)aniline. InChIKey: ZZBULULHFMWHMB-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-yl)aniline |
| InChIKey | ZZBULULHFMWHMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)N2C=NC=N2 |
Computed by PubChem (NCBI)