CAS 399017-39-1 appears in our catalog under these names: 2-Chloro-8-methylquinoline-3-carboxylic acid, 2-Chloro-8-methylquinoline-3-carboxylic acid, 98%, 98%, 2-Chloro-8-methylquinoline-3-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-chloro-8-methylquinoline-3-carboxylic acid (CAS 399017-39-1) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 2-chloro-8-methylquinoline-3-carboxylic acid. InChIKey: BVEMEOSELOITBF-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 2-chloro-8-methylquinoline-3-carboxylic acid |
| InChIKey | BVEMEOSELOITBF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=C(C(=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)