CAS 39999-42-3 is the registry number for 1,4-Anhydro-DL-ribitol. Offered by: TRC. Available pack sizes: 250mg.
(2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol (CAS 39999-42-3) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol. InChIKey: KZVAAIRBJJYZOW-LMVFSUKVSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | KZVAAIRBJJYZOW-LMVFSUKVSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H](O1)CO)O)O |
Computed by PubChem (NCBI)