CAS 40134-01-8 is the registry number for 7-Methoxy-2,3-dimethylisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-2,3-dimethylisoquinolin-1-one (CAS 40134-01-8) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 7-methoxy-2,3-dimethylisoquinolin-1-one. InChIKey: ZKVPTAXSACADGQ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 7-methoxy-2,3-dimethylisoquinolin-1-one |
| InChIKey | ZKVPTAXSACADGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2)OC)C(=O)N1C |
Computed by PubChem (NCBI)