Products 4014-90-8
CAS 4014-90-8 appears in our catalog under these names: N6-Benzyl-9H-purine-2,6-diamine 97%, N6-Benzyl-9H-purine-2,6-diamine, 97%,RG, 97%,RG, N6-benzyl-7H-purine-2,6-diamine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-N-benzyl-7H-purine-2,6-diamine (CAS 4014-90-8) is a chemical compound with the molecular formula C12H12N6 and a molecular weight of 240.26 g/mol. IUPAC name: 6-N-benzyl-7H-purine-2,6-diamine. InChIKey: XSSREOLCRTWEPI-UHFFFAOYSA-N.
| Molecular formula | C12H12N6 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 6-N-benzyl-7H-purine-2,6-diamine |
| InChIKey | XSSREOLCRTWEPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=NC3=C2NC=N3)N |
Computed by PubChem (NCBI)