CAS 402-42-6 appears in our catalog under these names: 4-Fluorobenzotrichloride, 97%, 1-Fluoro-4-(trichloromethyl)benzene, 98+%, 4–Fluorobenzotrichloride, 4-Fluorobenzotrichloride, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 500g, 100g, 5g, 25g, 1g.
1-fluoro-4-(trichloromethyl)benzene (CAS 402-42-6) is a chemical compound with the molecular formula C7H4Cl3F and a molecular weight of 213.5 g/mol. IUPAC name: 1-fluoro-4-(trichloromethyl)benzene. InChIKey: XOJYLEJZALFLLW-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3F |
|---|---|
| Molecular weight | 213.5 g/mol |
| IUPAC name | 1-fluoro-4-(trichloromethyl)benzene |
| InChIKey | XOJYLEJZALFLLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(Cl)(Cl)Cl)F |
Computed by PubChem (NCBI)