Products 890933-16-1
CAS 890933-16-1 is the registry number for 2-Chloro-1-(dichloromethyl)-4-fluorobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(dichloromethyl)-4-fluorobenzene (CAS 890933-16-1) is a chemical compound with the molecular formula C7H4Cl3F and a molecular weight of 213.5 g/mol. IUPAC name: 2-chloro-1-(dichloromethyl)-4-fluorobenzene. InChIKey: LNAKJPIBACZWIG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3F |
|---|---|
| Molecular weight | 213.5 g/mol |
| IUPAC name | 2-chloro-1-(dichloromethyl)-4-fluorobenzene |
| InChIKey | LNAKJPIBACZWIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)C(Cl)Cl |
Computed by PubChem (NCBI)