CAS 62476-62-4 is the registry number for 2-Chloro-6-fluorobenzal chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
1-chloro-2-(dichloromethyl)-3-fluorobenzene (CAS 62476-62-4) is a chemical compound with the molecular formula C7H4Cl3F and a molecular weight of 213.5 g/mol. IUPAC name: 1-chloro-2-(dichloromethyl)-3-fluorobenzene. InChIKey: LQIXIKRJISFVEC-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3F |
|---|---|
| Molecular weight | 213.5 g/mol |
| IUPAC name | 1-chloro-2-(dichloromethyl)-3-fluorobenzene |
| InChIKey | LQIXIKRJISFVEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(Cl)Cl)F |
Computed by PubChem (NCBI)