CAS 402-67-5 appears in our catalog under these names: 3–Fluoronitrobenzene, 1-Fluoro-3-nitrobenzene, 98+% , 3-Fluoronitrobenzene, >97.0%(GC), 1-Fluoro-3-nitrobenzene 98%, 1-FLUORO-3-NITROBENZENE, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 500g, 25g, 5g, 10g.
1-fluoro-3-nitrobenzene (CAS 402-67-5) is a chemical compound with the molecular formula C6H4FNO2 and a molecular weight of 141.10 g/mol. IUPAC name: 1-fluoro-3-nitrobenzene. InChIKey: WMASLRCNNKMRFP-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO2 |
|---|---|
| Molecular weight | 141.10 g/mol |
| IUPAC name | 1-fluoro-3-nitrobenzene |
| InChIKey | WMASLRCNNKMRFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)