CAS 40236-19-9 is the registry number for Benzyl 3,5-dimethylpyrrole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate (CAS 40236-19-9) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate. InChIKey: UBZQULOXHJSJTI-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | benzyl 3,5-dimethyl-1H-pyrrole-2-carboxylate |
| InChIKey | UBZQULOXHJSJTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1)C(=O)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)