CAS 40281-89-8 is the registry number for R,R-Warfarin Alcohol. Offered by: TRC. Available pack sizes: 100mg.
(R)-warfarin is a 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one that has (R)-configuration (the racemate is warfarin, an anticoagulant drug and rodenticide). It is a conjugate acid of a (R)-warfarin(1-). It is an enantiomer of a (S)-warfarin.
Source: ChEBI
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 4-hydroxy-3-[(1R)-3-oxo-1-phenylbutyl]chromen-2-one |
| InChIKey | PJVWKTKQMONHTI-OAHLLOKOSA-N |
| SMILES | CC(=O)C[C@H](C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)O |
Computed by PubChem (NCBI)