Products 40310-36-9
CAS 40310-36-9 is the registry number for (4-bromophenyl)(thiophen-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4-bromophenyl)-thiophen-2-ylmethanol (CAS 40310-36-9) is a chemical compound with the molecular formula C11H9BrOS and a molecular weight of 269.16 g/mol. IUPAC name: (4-bromophenyl)-thiophen-2-ylmethanol. InChIKey: UFRLLNUJMHVVMO-UHFFFAOYSA-N.
| Molecular formula | C11H9BrOS |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | (4-bromophenyl)-thiophen-2-ylmethanol |
| InChIKey | UFRLLNUJMHVVMO-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)