CAS 54095-24-8 appears in our catalog under these names: 2-Bromo-5-(4-methoxyphenyl)thiophene, 97%, 2-Bromo-5-(4-methoxyphenyl)thiophene, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-bromo-5-(4-methoxyphenyl)thiophene (CAS 54095-24-8) is a chemical compound with the molecular formula C11H9BrOS and a molecular weight of 269.16 g/mol. IUPAC name: 2-bromo-5-(4-methoxyphenyl)thiophene. InChIKey: JERXMXIBBDYMDR-UHFFFAOYSA-N.
| Molecular formula | C11H9BrOS |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | 2-bromo-5-(4-methoxyphenyl)thiophene |
| InChIKey | JERXMXIBBDYMDR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)