CAS 937795-99-8 is the registry number for [4-(3-Bromothien-2-yl)phenyl]methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
[4-(3-bromothiophen-2-yl)phenyl]methanol (CAS 937795-99-8) is a chemical compound with the molecular formula C11H9BrOS and a molecular weight of 269.16 g/mol. IUPAC name: [4-(3-bromothiophen-2-yl)phenyl]methanol. InChIKey: AQBJKGXCOBEPMC-UHFFFAOYSA-N.
| Molecular formula | C11H9BrOS |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | [4-(3-bromothiophen-2-yl)phenyl]methanol |
| InChIKey | AQBJKGXCOBEPMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)