Products 40357-43-5
CAS 40357-43-5 is the registry number for Isoneobavaisoflavone. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)-7-hydroxychromen-4-one (CAS 40357-43-5) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: 3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)-7-hydroxychromen-4-one. InChIKey: XYQGRDVFZGPOQG-UHFFFAOYSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)-7-hydroxychromen-4-one |
| InChIKey | XYQGRDVFZGPOQG-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=CC(=C2)C3=COC4=C(C3=O)C=CC(=C4)O)C |
Computed by PubChem (NCBI)